C16H31IN4O — CID 109484514
N-cyclopropyl-2-[[ethylamino-[hept-6-enyl(methyl)amino]methylidene]amino]acetamide;hydroiodide (PubChem CID 109484514) has the molecular formula C16H31IN4O and a molecular weight of 422.36 g/mol. Its IUPAC name is N-cyclopropyl-2-[[ethylamino-[hept-6-enyl(methyl)amino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-cyclopropyl-2-[[ethylamino-[hept-6-enyl(methyl)amino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 109484514 |
| Molecular Formula | C16H31IN4O |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | N-cyclopropyl-2-[[ethylamino-[hept-6-enyl(methyl)amino]methylidene]amino]acetamide;hydroiodide |
| SMILES | C=CCCCCCN(C)/C(=N/CC(=O)NC1CC1)NCC.I |
| InChI | InChI=1S/C16H30N4O.HI/c1-4-6-7-8-9-12-20(3)16(17-5-2)18-13-15(21)19-14-10-11-14;/h4,14H,1,5-13H2,2-3H3,(H,17,18)(H,19,21);1H |
| InChIKey | BQNGJRNUVJCGSW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|