C18H35IN4O — CID 109482892
N-cyclopentyl-3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]propanamide;hydroiodide (PubChem CID 109482892) has the molecular formula C18H35IN4O and a molecular weight of 450.41 g/mol. Its IUPAC name is N-cyclopentyl-3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]propanamide;hydroiodide.
| Compound Name | N-cyclopentyl-3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 109482892 |
| Molecular Formula | C18H35IN4O |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | N-cyclopentyl-3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]propanamide;hydroiodide |
| SMILES | C=CCCCCCN(C)/C(=N\C)NCCC(=O)NC1CCCC1.I |
| InChI | InChI=1S/C18H34N4O.HI/c1-4-5-6-7-10-15-22(3)18(19-2)20-14-13-17(23)21-16-11-8-9-12-16;/h4,16H,1,5-15H2,2-3H3,(H,19,20)(H,21,23);1H |
| InChIKey | DKKAKADSMTYEJG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|