C14H27N3O2 — CID 109483183
methyl 3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]propanoate (PubChem CID 109483183) has the molecular formula C14H27N3O2 and a molecular weight of 269.39 g/mol. Its IUPAC name is methyl 3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]propanoate.
| Compound Name | methyl 3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]propanoate |
|---|---|
| PubChem CID | 109483183 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | methyl 3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]propanoate |
| SMILES | C=CCCCCCN(C)/C(=N/C)NCCC(=O)OC |
| InChI | InChI=1S/C14H27N3O2/c1-5-6-7-8-9-12-17(3)14(15-2)16-11-10-13(18)19-4/h5H,1,6-12H2,2-4H3,(H,15,16) |
| InChIKey | LMOLJWPEOYUBAV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|