C15H30N4O — CID 109496205
N-butan-2-yl-3-[(N,N'-dimethyl-N-pent-4-enylcarbamimidoyl)amino]propanamide (PubChem CID 109496205) has the molecular formula C15H30N4O and a molecular weight of 282.43 g/mol. Its IUPAC name is N-butan-2-yl-3-[(N,N'-dimethyl-N-pent-4-enylcarbamimidoyl)amino]propanamide.
| Compound Name | N-butan-2-yl-3-[(N,N'-dimethyl-N-pent-4-enylcarbamimidoyl)amino]propanamide |
|---|---|
| PubChem CID | 109496205 |
| Molecular Formula | C15H30N4O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | N-butan-2-yl-3-[(N,N'-dimethyl-N-pent-4-enylcarbamimidoyl)amino]propanamide |
| SMILES | C=CCCCN(C)/C(=N/C)NCCC(=O)NC(C)CC |
| InChI | InChI=1S/C15H30N4O/c1-6-8-9-12-19(5)15(16-4)17-11-10-14(20)18-13(3)7-2/h6,13H,1,7-12H2,2-5H3,(H,16,17)(H,18,20) |
| InChIKey | LAIBCZYSWLRUAL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|