C15H31N3 — CID 109499166
3-(4,4-dimethylpentyl)-1,2-dimethyl-1-pent-4-enylguanidine (PubChem CID 109499166) has the molecular formula C15H31N3 and a molecular weight of 253.43 g/mol. Its IUPAC name is 3-(4,4-dimethylpentyl)-1,2-dimethyl-1-pent-4-enylguanidine.
| Compound Name | 3-(4,4-dimethylpentyl)-1,2-dimethyl-1-pent-4-enylguanidine |
|---|---|
| PubChem CID | 109499166 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | 3-(4,4-dimethylpentyl)-1,2-dimethyl-1-pent-4-enylguanidine |
| SMILES | C=CCCCN(C)/C(=N/C)NCCCC(C)(C)C |
| InChI | InChI=1S/C15H31N3/c1-7-8-9-13-18(6)14(16-5)17-12-10-11-15(2,3)4/h7H,1,8-13H2,2-6H3,(H,16,17) |
| InChIKey | HXZIVZCCWZJFHF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|