C12H25N3O2S — CID 109496093
3-(2-ethylsulfonylethyl)-1,2-dimethyl-1-pent-4-enylguanidine (PubChem CID 109496093) has the molecular formula C12H25N3O2S and a molecular weight of 275.42 g/mol. Its IUPAC name is 3-(2-ethylsulfonylethyl)-1,2-dimethyl-1-pent-4-enylguanidine.
| Compound Name | 3-(2-ethylsulfonylethyl)-1,2-dimethyl-1-pent-4-enylguanidine |
|---|---|
| PubChem CID | 109496093 |
| Molecular Formula | C12H25N3O2S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 3-(2-ethylsulfonylethyl)-1,2-dimethyl-1-pent-4-enylguanidine |
| SMILES | C=CCCCN(C)/C(=N\C)NCCS(=O)(=O)CC |
| InChI | InChI=1S/C12H25N3O2S/c1-5-7-8-10-15(4)12(13-3)14-9-11-18(16,17)6-2/h5H,1,6-11H2,2-4H3,(H,13,14) |
| InChIKey | IFHMQHLZSAXHEF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|