C14H26N6 — CID 109499112
1,2-dimethyl-1-pent-4-enyl-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine (PubChem CID 109499112) has the molecular formula C14H26N6 and a molecular weight of 278.40 g/mol. Its IUPAC name is 1,2-dimethyl-1-pent-4-enyl-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine.
| Compound Name | 1,2-dimethyl-1-pent-4-enyl-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine |
|---|---|
| PubChem CID | 109499112 |
| Molecular Formula | C14H26N6 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 1,2-dimethyl-1-pent-4-enyl-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine |
| SMILES | C=CCCCN(C)/C(=N\C)NCCCCn1cnnc1 |
| InChI | InChI=1S/C14H26N6/c1-4-5-7-10-19(3)14(15-2)16-9-6-8-11-20-12-17-18-13-20/h4,12-13H,1,5-11H2,2-3H3,(H,15,16) |
| InChIKey | YSBFPWGKELMJBN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|