C14H30N4 — CID 109499408
3-[2-(dimethylamino)-2-methylpropyl]-1,2-dimethyl-1-pent-4-enylguanidine (PubChem CID 109499408) has the molecular formula C14H30N4 and a molecular weight of 254.42 g/mol. Its IUPAC name is 3-[2-(dimethylamino)-2-methylpropyl]-1,2-dimethyl-1-pent-4-enylguanidine.
| Compound Name | 3-[2-(dimethylamino)-2-methylpropyl]-1,2-dimethyl-1-pent-4-enylguanidine |
|---|---|
| PubChem CID | 109499408 |
| Molecular Formula | C14H30N4 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.25 |
| IUPAC Name | 3-[2-(dimethylamino)-2-methylpropyl]-1,2-dimethyl-1-pent-4-enylguanidine |
| SMILES | C=CCCCN(C)/C(=N\C)NCC(C)(C)N(C)C |
| InChI | InChI=1S/C14H30N4/c1-8-9-10-11-18(7)13(15-4)16-12-14(2,3)17(5)6/h8H,1,9-12H2,2-7H3,(H,15,16) |
| InChIKey | QXDXOMUQNAIUGL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|