C19H31IN4O — CID 110951957
3-[(N-benzyl-N,N'-dimethylcarbamimidoyl)amino]-N-cyclohexylpropanamide;hydroiodide (PubChem CID 110951957) has the molecular formula C19H31IN4O and a molecular weight of 458.39 g/mol. Its IUPAC name is 3-[(N-benzyl-N,N'-dimethylcarbamimidoyl)amino]-N-cyclohexylpropanamide;hydroiodide.
| Compound Name | 3-[(N-benzyl-N,N'-dimethylcarbamimidoyl)amino]-N-cyclohexylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 110951957 |
| Molecular Formula | C19H31IN4O |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 3-[(N-benzyl-N,N'-dimethylcarbamimidoyl)amino]-N-cyclohexylpropanamide;hydroiodide |
| SMILES | C/N=C(/NCCC(=O)NC1CCCCC1)N(C)Cc1ccccc1.I |
| InChI | InChI=1S/C19H30N4O.HI/c1-20-19(23(2)15-16-9-5-3-6-10-16)21-14-13-18(24)22-17-11-7-4-8-12-17;/h3,5-6,9-10,17H,4,7-8,11-15H2,1-2H3,(H,20,21)(H,22,24);1H |
| InChIKey | TUBMHJGPNAFTIU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|