C20H26BrIN4O — CID 111292802
N-benzyl-3-[[N-[(4-bromophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111292802) has the molecular formula C20H26BrIN4O and a molecular weight of 545.26 g/mol. Its IUPAC name is N-benzyl-3-[[N-[(4-bromophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-benzyl-3-[[N-[(4-bromophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111292802 |
| Molecular Formula | C20H26BrIN4O |
| Molecular Weight | 545.26 g/mol |
| Exact Mass | 544.03 |
| IUPAC Name | N-benzyl-3-[[N-[(4-bromophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(\NCCC(=O)NCc1ccccc1)N(C)Cc1ccc(Br)cc1.I |
| InChI | InChI=1S/C20H25BrN4O.HI/c1-22-20(25(2)15-17-8-10-18(21)11-9-17)23-13-12-19(26)24-14-16-6-4-3-5-7-16;/h3-11H,12-15H2,1-2H3,(H,22,23)(H,24,26);1H |
| InChIKey | AMHPUKHSBGLHIG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.26 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|