C20H26N4O2 — CID 111272293
N-benzyl-2-[[N-[(4-methoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]acetamide (PubChem CID 111272293) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is N-benzyl-2-[[N-[(4-methoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]acetamide.
| Compound Name | N-benzyl-2-[[N-[(4-methoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111272293 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | N-benzyl-2-[[N-[(4-methoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)NCc1ccccc1)N(C)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C20H26N4O2/c1-21-20(24(2)15-17-9-11-18(26-3)12-10-17)23-14-19(25)22-13-16-7-5-4-6-8-16/h4-12H,13-15H2,1-3H3,(H,21,23)(H,22,25) |
| InChIKey | CKGGTWAFKAKKLT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|