C21H27N5O3 — CID 111272417
N-(2-amino-2-oxoethyl)-4-[[[N-[(4-methoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]benzamide (PubChem CID 111272417) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-[[[N-[(4-methoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-[[[N-[(4-methoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111272417 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-[[[N-[(4-methoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(/NCc1ccc(C(=O)NCC(N)=O)cc1)N(C)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H27N5O3/c1-23-21(26(2)14-16-6-10-18(29-3)11-7-16)25-12-15-4-8-17(9-5-15)20(28)24-13-19(22)27/h4-11H,12-14H2,1-3H3,(H2,22,27)(H,23,25)(H,24,28) |
| InChIKey | VDSPJFHMZRTJKV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|