C21H27F2IN4O2 — CID 111288210
2-[[N-[[4-(difluoromethoxy)phenyl]methyl]-N,N'-dimethylcarbamimidoyl]amino]-N-(2-phenylethyl)acetamide;hydroiodide (PubChem CID 111288210) has the molecular formula C21H27F2IN4O2 and a molecular weight of 532.37 g/mol. Its IUPAC name is 2-[[N-[[4-(difluoromethoxy)phenyl]methyl]-N,N'-dimethylcarbamimidoyl]amino]-N-(2-phenylethyl)acetamide;hydroiodide.
| Compound Name | 2-[[N-[[4-(difluoromethoxy)phenyl]methyl]-N,N'-dimethylcarbamimidoyl]amino]-N-(2-phenylethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111288210 |
| Molecular Formula | C21H27F2IN4O2 |
| Molecular Weight | 532.37 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | 2-[[N-[[4-(difluoromethoxy)phenyl]methyl]-N,N'-dimethylcarbamimidoyl]amino]-N-(2-phenylethyl)acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)NCCc1ccccc1)N(C)Cc1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C21H26F2N4O2.HI/c1-24-21(26-14-19(28)25-13-12-16-6-4-3-5-7-16)27(2)15-17-8-10-18(11-9-17)29-20(22)23;/h3-11,20H,12-15H2,1-2H3,(H,24,26)(H,25,28);1H |
| InChIKey | VALUULQKJAWFQM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|