C17H21F2N3OS — CID 111288369
1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111288369) has the molecular formula C17H21F2N3OS and a molecular weight of 353.44 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111288369 |
| Molecular Formula | C17H21F2N3OS |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-(2-thiophen-2-ylethyl)guanidine |
| SMILES | C/N=C(\NCCc1cccs1)N(C)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H21F2N3OS/c1-20-17(21-10-9-15-4-3-11-24-15)22(2)12-13-5-7-14(8-6-13)23-16(18)19/h3-8,11,16H,9-10,12H2,1-2H3,(H,20,21) |
| InChIKey | WNGJLWIPDQRWPK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|