C16H26F2IN3O4S — CID 111514389
1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide (PubChem CID 111514389) has the molecular formula C16H26F2IN3O4S and a molecular weight of 521.37 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111514389 |
| Molecular Formula | C16H26F2IN3O4S |
| Molecular Weight | 521.37 g/mol |
| Exact Mass | 521.07 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCOCCS(C)(=O)=O)N(C)Cc1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C16H25F2N3O4S.HI/c1-19-16(20-8-9-24-10-11-26(3,22)23)21(2)12-13-4-6-14(7-5-13)25-15(17)18;/h4-7,15H,8-12H2,1-3H3,(H,19,20);1H |
| InChIKey | ZMENUVNLUPKRSK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|