C20H27F2IN4O3S — CID 111287916
1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111287916) has the molecular formula C20H27F2IN4O3S and a molecular weight of 568.43 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111287916 |
| Molecular Formula | C20H27F2IN4O3S |
| Molecular Weight | 568.43 g/mol |
| Exact Mass | 568.08 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(CS(=O)(=O)NC)cc1)N(C)Cc1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C20H26F2N4O3S.HI/c1-23-20(26(3)13-16-8-10-18(11-9-16)29-19(21)22)25-12-15-4-6-17(7-5-15)14-30(27,28)24-2;/h4-11,19,24H,12-14H2,1-3H3,(H,23,25);1H |
| InChIKey | CMSATJCFIKPCME-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|