C18H23F2IN4O2 — CID 111287812
1-[[4-(difluoromethoxy)phenyl]methyl]-3-[(6-methoxy-3-pyridinyl)methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111287812) has the molecular formula C18H23F2IN4O2 and a molecular weight of 492.31 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[(6-methoxy-3-pyridinyl)methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[(6-methoxy-3-pyridinyl)methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111287812 |
| Molecular Formula | C18H23F2IN4O2 |
| Molecular Weight | 492.31 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[(6-methoxy-3-pyridinyl)methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(OC)nc1)N(C)Cc1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C18H22F2N4O2.HI/c1-21-18(23-11-14-6-9-16(25-3)22-10-14)24(2)12-13-4-7-15(8-5-13)26-17(19)20;/h4-10,17H,11-12H2,1-3H3,(H,21,23);1H |
| InChIKey | LMFDFJUOFKWRLC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|