C20H26F3IN4O2 — CID 111299546
3-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-1,2-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111299546) has the molecular formula C20H26F3IN4O2 and a molecular weight of 538.35 g/mol. Its IUPAC name is 3-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-1,2-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 3-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-1,2-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111299546 |
| Molecular Formula | C20H26F3IN4O2 |
| Molecular Weight | 538.35 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | 3-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-1,2-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(OCCOC)nc1)N(C)Cc1ccc(C(F)(F)F)cc1.I |
| InChI | InChI=1S/C20H25F3N4O2.HI/c1-24-19(26-13-16-6-9-18(25-12-16)29-11-10-28-3)27(2)14-15-4-7-17(8-5-15)20(21,22)23;/h4-9,12H,10-11,13-14H2,1-3H3,(H,24,26);1H |
| InChIKey | RSCIGHFJPNSUBV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|