C17H22FIN4 — CID 119132067
1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[(6-methyl-3-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 119132067) has the molecular formula C17H22FIN4 and a molecular weight of 428.29 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[(6-methyl-3-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[(6-methyl-3-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119132067 |
| Molecular Formula | C17H22FIN4 |
| Molecular Weight | 428.29 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[(6-methyl-3-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(C)nc1)N(C)Cc1ccc(F)cc1.I |
| InChI | InChI=1S/C17H21FN4.HI/c1-13-4-5-15(10-20-13)11-21-17(19-2)22(3)12-14-6-8-16(18)9-7-14;/h4-10H,11-12H2,1-3H3,(H,19,21);1H |
| InChIKey | UEJPZUXQOZLYJU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|