C11H17FIN3 — CID 111306530
1-[(4-fluorophenyl)methyl]-1,2,3-trimethylguanidine;hydroiodide (PubChem CID 111306530) has the molecular formula C11H17FIN3 and a molecular weight of 337.18 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1,2,3-trimethylguanidine;hydroiodide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-1,2,3-trimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111306530 |
| Molecular Formula | C11H17FIN3 |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1,2,3-trimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NC)N(C)Cc1ccc(F)cc1.I |
| InChI | InChI=1S/C11H16FN3.HI/c1-13-11(14-2)15(3)8-9-4-6-10(12)7-5-9;/h4-7H,8H2,1-3H3,(H,13,14);1H |
| InChIKey | KDPXBBHRWJIWPD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|