C12H16F3N3 — CID 111299561
1,2,3-trimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111299561) has the molecular formula C12H16F3N3 and a molecular weight of 259.28 g/mol. Its IUPAC name is 1,2,3-trimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1,2,3-trimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111299561 |
| Molecular Formula | C12H16F3N3 |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 1,2,3-trimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NC)N(C)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H16F3N3/c1-16-11(17-2)18(3)8-9-4-6-10(7-5-9)12(13,14)15/h4-7H,8H2,1-3H3,(H,16,17) |
| InChIKey | CGRJQXBULQBLHR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|