C14H20F3N3 — CID 111299563
2,3-diethyl-1-methyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111299563) has the molecular formula C14H20F3N3 and a molecular weight of 287.33 g/mol. Its IUPAC name is 2,3-diethyl-1-methyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 2,3-diethyl-1-methyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111299563 |
| Molecular Formula | C14H20F3N3 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2,3-diethyl-1-methyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CC/N=C(\NCC)N(C)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H20F3N3/c1-4-18-13(19-5-2)20(3)10-11-6-8-12(9-7-11)14(15,16)17/h6-9H,4-5,10H2,1-3H3,(H,18,19) |
| InChIKey | ISZCKMGXVVTLEK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|