C14H24IN3 — CID 111288888
2,3-diethyl-1-methyl-1-[(4-methylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111288888) has the molecular formula C14H24IN3 and a molecular weight of 361.27 g/mol. Its IUPAC name is 2,3-diethyl-1-methyl-1-[(4-methylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2,3-diethyl-1-methyl-1-[(4-methylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111288888 |
| Molecular Formula | C14H24IN3 |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 2,3-diethyl-1-methyl-1-[(4-methylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CC/N=C(\NCC)N(C)Cc1ccc(C)cc1.I |
| InChI | InChI=1S/C14H23N3.HI/c1-5-15-14(16-6-2)17(4)11-13-9-7-12(3)8-10-13;/h7-10H,5-6,11H2,1-4H3,(H,15,16);1H |
| InChIKey | WLDDVRSDQOGJKW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|