C19H25F3N4O2 — CID 111500829
2-[2-(2,6-dioxopiperidin-1-yl)ethyl]-3-ethyl-1-methyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111500829) has the molecular formula C19H25F3N4O2 and a molecular weight of 398.43 g/mol. Its IUPAC name is 2-[2-(2,6-dioxopiperidin-1-yl)ethyl]-3-ethyl-1-methyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 2-[2-(2,6-dioxopiperidin-1-yl)ethyl]-3-ethyl-1-methyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111500829 |
| Molecular Formula | C19H25F3N4O2 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 2-[2-(2,6-dioxopiperidin-1-yl)ethyl]-3-ethyl-1-methyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\CCN1C(=O)CCCC1=O)N(C)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H25F3N4O2/c1-3-23-18(24-11-12-26-16(27)5-4-6-17(26)28)25(2)13-14-7-9-15(10-8-14)19(20,21)22/h7-10H,3-6,11-13H2,1-2H3,(H,23,24) |
| InChIKey | PVPWSDWEPGWYBX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|