C22H29F3N4O — CID 111300219
3-ethyl-1-methyl-2-[4-(2-methyl-6-oxo-1-pyridinyl)butyl]-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111300219) has the molecular formula C22H29F3N4O and a molecular weight of 422.50 g/mol. Its IUPAC name is 3-ethyl-1-methyl-2-[4-(2-methyl-6-oxo-1-pyridinyl)butyl]-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 3-ethyl-1-methyl-2-[4-(2-methyl-6-oxo-1-pyridinyl)butyl]-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111300219 |
| Molecular Formula | C22H29F3N4O |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 3-ethyl-1-methyl-2-[4-(2-methyl-6-oxo-1-pyridinyl)butyl]-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\CCCCn1c(C)cccc1=O)N(C)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H29F3N4O/c1-4-26-21(27-14-5-6-15-29-17(2)8-7-9-20(29)30)28(3)16-18-10-12-19(13-11-18)22(23,24)25/h7-13H,4-6,14-16H2,1-3H3,(H,26,27) |
| InChIKey | BNWPCGWMBSJWQF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|