C15H19F3IN3 — CID 111300216
3-ethyl-1-methyl-2-prop-2-ynyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111300216) has the molecular formula C15H19F3IN3 and a molecular weight of 425.24 g/mol. Its IUPAC name is 3-ethyl-1-methyl-2-prop-2-ynyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-2-prop-2-ynyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111300216 |
| Molecular Formula | C15H19F3IN3 |
| Molecular Weight | 425.24 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 3-ethyl-1-methyl-2-prop-2-ynyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C#CC/N=C(\NCC)N(C)Cc1ccc(C(F)(F)F)cc1.I |
| InChI | InChI=1S/C15H18F3N3.HI/c1-4-10-20-14(19-5-2)21(3)11-12-6-8-13(9-7-12)15(16,17)18;/h1,6-9H,5,10-11H2,2-3H3,(H,19,20);1H |
| InChIKey | USUVWBOPMJLHCH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.24 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|