C19H27F6IN4 — CID 111299608
3-ethyl-1-methyl-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111299608) has the molecular formula C19H27F6IN4 and a molecular weight of 552.35 g/mol. Its IUPAC name is 3-ethyl-1-methyl-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111299608 |
| Molecular Formula | C19H27F6IN4 |
| Molecular Weight | 552.35 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | 3-ethyl-1-methyl-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCN(CC(F)(F)F)C1)N(C)Cc1ccc(C(F)(F)F)cc1.I |
| InChI | InChI=1S/C19H26F6N4.HI/c1-3-26-17(27-10-15-8-9-29(12-15)13-18(20,21)22)28(2)11-14-4-6-16(7-5-14)19(23,24)25;/h4-7,15H,3,8-13H2,1-2H3,(H,26,27);1H |
| InChIKey | VCWIGXAIPXUUCC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.35 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|