C18H27F4IN4 — CID 111285082
3-ethyl-1-[(3-fluorophenyl)methyl]-1-methyl-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide (PubChem CID 111285082) has the molecular formula C18H27F4IN4 and a molecular weight of 502.34 g/mol. Its IUPAC name is 3-ethyl-1-[(3-fluorophenyl)methyl]-1-methyl-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-[(3-fluorophenyl)methyl]-1-methyl-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111285082 |
| Molecular Formula | C18H27F4IN4 |
| Molecular Weight | 502.34 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 3-ethyl-1-[(3-fluorophenyl)methyl]-1-methyl-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCN(CC(F)(F)F)C1)N(C)Cc1cccc(F)c1.I |
| InChI | InChI=1S/C18H26F4N4.HI/c1-3-23-17(25(2)11-14-5-4-6-16(19)9-14)24-10-15-7-8-26(12-15)13-18(20,21)22;/h4-6,9,15H,3,7-8,10-13H2,1-2H3,(H,23,24);1H |
| InChIKey | OWFDJVDFZSSLTA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|