C21H37FIN5 — CID 111286130
3-ethyl-2-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1-[(3-fluorophenyl)methyl]-1-methylguanidine;hydroiodide (PubChem CID 111286130) has the molecular formula C21H37FIN5 and a molecular weight of 505.46 g/mol. Its IUPAC name is 3-ethyl-2-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1-[(3-fluorophenyl)methyl]-1-methylguanidine;hydroiodide.
| Compound Name | 3-ethyl-2-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1-[(3-fluorophenyl)methyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111286130 |
| Molecular Formula | C21H37FIN5 |
| Molecular Weight | 505.46 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | 3-ethyl-2-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1-[(3-fluorophenyl)methyl]-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)CN1CCN(CC)CC1)N(C)Cc1cccc(F)c1.I |
| InChI | InChI=1S/C21H36FN5.HI/c1-5-23-21(25(4)17-19-8-7-9-20(22)14-19)24-15-18(3)16-27-12-10-26(6-2)11-13-27;/h7-9,14,18H,5-6,10-13,15-17H2,1-4H3,(H,23,24);1H |
| InChIKey | RHNYDUOIKPPLJA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|