C22H40IN5S — CID 111299368
3-ethyl-2-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1-methyl-1-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111299368) has the molecular formula C22H40IN5S and a molecular weight of 533.57 g/mol. Its IUPAC name is 3-ethyl-2-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1-methyl-1-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-2-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1-methyl-1-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111299368 |
| Molecular Formula | C22H40IN5S |
| Molecular Weight | 533.57 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | 3-ethyl-2-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1-methyl-1-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)CN1CCN(CC)CC1)N(C)Cc1ccc(SC)cc1.I |
| InChI | InChI=1S/C22H39N5S.HI/c1-6-23-22(25(4)18-20-8-10-21(28-5)11-9-20)24-16-19(3)17-27-14-12-26(7-2)13-15-27;/h8-11,19H,6-7,12-18H2,1-5H3,(H,23,24);1H |
| InChIKey | NYRBMSAAVKFIOV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|