C22H40IN5 — CID 111283102
1-[(4-ethylphenyl)methyl]-3-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111283102) has the molecular formula C22H40IN5 and a molecular weight of 501.50 g/mol. Its IUPAC name is 1-[(4-ethylphenyl)methyl]-3-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[(4-ethylphenyl)methyl]-3-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111283102 |
| Molecular Formula | C22H40IN5 |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | 1-[(4-ethylphenyl)methyl]-3-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | CCc1ccc(CN(C)/C(=N/C)NCC(C)CN2CCN(CC)CC2)cc1.I |
| InChI | InChI=1S/C22H39N5.HI/c1-6-20-8-10-21(11-9-20)18-25(5)22(23-4)24-16-19(3)17-27-14-12-26(7-2)13-15-27;/h8-11,19H,6-7,12-18H2,1-5H3,(H,23,24);1H |
| InChIKey | TWEFSYMTOIBWIL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|