C17H33IN6S — CID 109423981
1,2-dimethyl-3-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109423981) has the molecular formula C17H33IN6S and a molecular weight of 480.46 g/mol. Its IUPAC name is 1,2-dimethyl-3-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-3-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109423981 |
| Molecular Formula | C17H33IN6S |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 1,2-dimethyl-3-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCC(C)CN1CCN(C)CC1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C17H32N6S.HI/c1-14(11-23-8-6-21(4)7-9-23)10-19-17(18-3)22(5)12-16-13-24-15(2)20-16;/h13-14H,6-12H2,1-5H3,(H,18,19);1H |
| InChIKey | BIIVXRKYIIUQBE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 47.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|