C16H30N6S — CID 109424072
1,2-dimethyl-3-[2-(4-methylpiperazin-1-yl)propyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109424072) has the molecular formula C16H30N6S and a molecular weight of 338.53 g/mol. Its IUPAC name is 1,2-dimethyl-3-[2-(4-methylpiperazin-1-yl)propyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 1,2-dimethyl-3-[2-(4-methylpiperazin-1-yl)propyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109424072 |
| Molecular Formula | C16H30N6S |
| Molecular Weight | 338.53 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | 1,2-dimethyl-3-[2-(4-methylpiperazin-1-yl)propyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCC(C)N1CCN(C)CC1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C16H30N6S/c1-13(22-8-6-20(4)7-9-22)10-18-16(17-3)21(5)11-15-12-23-14(2)19-15/h12-13H,6-11H2,1-5H3,(H,17,18) |
| InChIKey | OMVVWYHGVKHCMI-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 47.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.53 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|