C18H30Cl2IN5 — CID 111306394
1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[2-(4-methylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111306394) has the molecular formula C18H30Cl2IN5 and a molecular weight of 514.28 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[2-(4-methylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[2-(4-methylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111306394 |
| Molecular Formula | C18H30Cl2IN5 |
| Molecular Weight | 514.28 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[2-(4-methylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCC(C)N1CCN(C)CC1)N(C)Cc1ccc(Cl)c(Cl)c1.I |
| InChI | InChI=1S/C18H29Cl2N5.HI/c1-14(25-9-7-23(3)8-10-25)12-22-18(21-2)24(4)13-15-5-6-16(19)17(20)11-15;/h5-6,11,14H,7-10,12-13H2,1-4H3,(H,21,22);1H |
| InChIKey | UPOIGQFMYFIKTM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|