C16H25Cl2IN4O3S — CID 111306192
1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-(2-morpholin-4-ylsulfonylethyl)guanidine;hydroiodide (PubChem CID 111306192) has the molecular formula C16H25Cl2IN4O3S and a molecular weight of 551.28 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-(2-morpholin-4-ylsulfonylethyl)guanidine;hydroiodide.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-(2-morpholin-4-ylsulfonylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111306192 |
| Molecular Formula | C16H25Cl2IN4O3S |
| Molecular Weight | 551.28 g/mol |
| Exact Mass | 550.01 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-(2-morpholin-4-ylsulfonylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCS(=O)(=O)N1CCOCC1)N(C)Cc1ccc(Cl)c(Cl)c1.I |
| InChI | InChI=1S/C16H24Cl2N4O3S.HI/c1-19-16(21(2)12-13-3-4-14(17)15(18)11-13)20-5-10-26(23,24)22-6-8-25-9-7-22;/h3-4,11H,5-10,12H2,1-2H3,(H,19,20);1H |
| InChIKey | JTMJJNWGCCLPMM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|