C19H27Cl2IN6O — CID 111306418
1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide (PubChem CID 111306418) has the molecular formula C19H27Cl2IN6O and a molecular weight of 553.28 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111306418 |
| Molecular Formula | C19H27Cl2IN6O |
| Molecular Weight | 553.28 g/mol |
| Exact Mass | 552.07 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCn1nc2n(c1=O)CCCC2)N(C)Cc1ccc(Cl)c(Cl)c1.I |
| InChI | InChI=1S/C19H26Cl2N6O.HI/c1-22-18(25(2)13-14-7-8-15(20)16(21)12-14)23-9-5-11-27-19(28)26-10-4-3-6-17(26)24-27;/h7-8,12H,3-6,9-11,13H2,1-2H3,(H,22,23);1H |
| InChIKey | BDRVBELPPLFAGA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|