C19H28FIN6O — CID 111853461
1-[(4-fluoro-3-methylphenyl)methyl]-2-methyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide (PubChem CID 111853461) has the molecular formula C19H28FIN6O and a molecular weight of 502.38 g/mol. Its IUPAC name is 1-[(4-fluoro-3-methylphenyl)methyl]-2-methyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[(4-fluoro-3-methylphenyl)methyl]-2-methyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111853461 |
| Molecular Formula | C19H28FIN6O |
| Molecular Weight | 502.38 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | 1-[(4-fluoro-3-methylphenyl)methyl]-2-methyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCn1nc2n(c1=O)CCCC2)NCc1ccc(F)c(C)c1.I |
| InChI | InChI=1S/C19H27FN6O.HI/c1-14-12-15(7-8-16(14)20)13-23-18(21-2)22-9-5-11-26-19(27)25-10-4-3-6-17(25)24-26;/h7-8,12H,3-6,9-11,13H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | HQYMRINICSLLID-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|