C16H24N6OS — CID 111259965
2-methyl-1-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3-(thiophen-2-ylmethyl)guanidine (PubChem CID 111259965) has the molecular formula C16H24N6OS and a molecular weight of 348.48 g/mol. Its IUPAC name is 2-methyl-1-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 2-methyl-1-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111259965 |
| Molecular Formula | C16H24N6OS |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-methyl-1-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3-(thiophen-2-ylmethyl)guanidine |
| SMILES | C/N=C(/NCCCn1nc2n(c1=O)CCCC2)NCc1cccs1 |
| InChI | InChI=1S/C16H24N6OS/c1-17-15(19-12-13-6-4-11-24-13)18-8-5-10-22-16(23)21-9-3-2-7-14(21)20-22/h4,6,11H,2-3,5,7-10,12H2,1H3,(H2,17,18,19) |
| InChIKey | QRUPOPKHPYTQRV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|