C18H24Cl2N6 — CID 111306225
1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine (PubChem CID 111306225) has the molecular formula C18H24Cl2N6 and a molecular weight of 395.34 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111306225 |
| Molecular Formula | C18H24Cl2N6 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-1,2-dimethyl-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine |
| SMILES | C/N=C(/NCc1nnc2n1CCCCC2)N(C)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H24Cl2N6/c1-21-18(25(2)12-13-7-8-14(19)15(20)10-13)22-11-17-24-23-16-6-4-3-5-9-26(16)17/h7-8,10H,3-6,9,11-12H2,1-2H3,(H,21,22) |
| InChIKey | UTZWPPUSORGFBV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|