C17H23F2IN6O — CID 111288278
1-[[4-(difluoromethoxy)phenyl]methyl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1,2-dimethylguanidine;hydroiodide (PubChem CID 111288278) has the molecular formula C17H23F2IN6O and a molecular weight of 492.31 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111288278 |
| Molecular Formula | C17H23F2IN6O |
| Molecular Weight | 492.31 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nnc2n1CCC2)N(C)Cc1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C17H22F2N6O.HI/c1-20-17(21-10-15-23-22-14-4-3-9-25(14)15)24(2)11-12-5-7-13(8-6-12)26-16(18)19;/h5-8,16H,3-4,9-11H2,1-2H3,(H,20,21);1H |
| InChIKey | ZZTTYBNPSIXGNR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|