C16H22F2IN5O — CID 111288548
1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111288548) has the molecular formula C16H22F2IN5O and a molecular weight of 465.29 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111288548 |
| Molecular Formula | C16H22F2IN5O |
| Molecular Weight | 465.29 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cnn(C)c1)N(C)Cc1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C16H21F2N5O.HI/c1-19-16(20-8-13-9-21-23(3)11-13)22(2)10-12-4-6-14(7-5-12)24-15(17)18;/h4-7,9,11,15H,8,10H2,1-3H3,(H,19,20);1H |
| InChIKey | CCFWGXPHOMNNNQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 54.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|