C22H31F2IN6O — CID 111288684
1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 111288684) has the molecular formula C22H31F2IN6O and a molecular weight of 560.43 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111288684 |
| Molecular Formula | C22H31F2IN6O |
| Molecular Weight | 560.43 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccnc1N1CCN(C)CC1)N(C)Cc1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C22H30F2N6O.HI/c1-25-22(29(3)16-17-6-8-19(9-7-17)31-21(23)24)27-15-18-5-4-10-26-20(18)30-13-11-28(2)12-14-30;/h4-10,21H,11-16H2,1-3H3,(H,25,27);1H |
| InChIKey | BHHKYBIRSJKAKN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|