C21H28F2IN3O4 — CID 111288418
1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111288418) has the molecular formula C21H28F2IN3O4 and a molecular weight of 551.37 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111288418 |
| Molecular Formula | C21H28F2IN3O4 |
| Molecular Weight | 551.37 g/mol |
| Exact Mass | 551.11 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OC)c(OC)c1OC)N(C)Cc1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C21H27F2N3O4.HI/c1-24-21(26(2)13-14-6-9-16(10-7-14)30-20(22)23)25-12-15-8-11-17(27-3)19(29-5)18(15)28-4;/h6-11,20H,12-13H2,1-5H3,(H,24,25);1H |
| InChIKey | RDYRAFRPMKDLKU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 64.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|