C21H30IN5OS — CID 111299306
1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]-3-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 111299306) has the molecular formula C21H30IN5OS and a molecular weight of 527.48 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]-3-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]-3-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111299306 |
| Molecular Formula | C21H30IN5OS |
| Molecular Weight | 527.48 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | 1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]-3-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccnc1N1CCOCC1)N(C)Cc1ccc(SC)cc1.I |
| InChI | InChI=1S/C21H29N5OS.HI/c1-22-21(25(2)16-17-6-8-19(28-3)9-7-17)24-15-18-5-4-10-23-20(18)26-11-13-27-14-12-26;/h4-10H,11-16H2,1-3H3,(H,22,24);1H |
| InChIKey | SLGJLAMMELMLKL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|