C22H29FN6O — CID 111285593
1-[3-[[[N-[(3-fluorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide (PubChem CID 111285593) has the molecular formula C22H29FN6O and a molecular weight of 412.51 g/mol. Its IUPAC name is 1-[3-[[[N-[(3-fluorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-[[[N-[(3-fluorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 111285593 |
| Molecular Formula | C22H29FN6O |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 1-[3-[[[N-[(3-fluorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide |
| SMILES | C/N=C(/NCc1cccnc1N1CCC(C(N)=O)CC1)N(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C22H29FN6O/c1-25-22(28(2)15-16-5-3-7-19(23)13-16)27-14-18-6-4-10-26-21(18)29-11-8-17(9-12-29)20(24)30/h3-7,10,13,17H,8-9,11-12,14-15H2,1-2H3,(H2,24,30)(H,25,27) |
| InChIKey | DOJIVUDHECKPQQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|