C22H30N6O — CID 111244267
1-[3-[[[N'-methyl-N-[(4-methylphenyl)methyl]carbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide (PubChem CID 111244267) has the molecular formula C22H30N6O and a molecular weight of 394.52 g/mol. Its IUPAC name is 1-[3-[[[N'-methyl-N-[(4-methylphenyl)methyl]carbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-[[[N'-methyl-N-[(4-methylphenyl)methyl]carbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 111244267 |
| Molecular Formula | C22H30N6O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 1-[3-[[[N'-methyl-N-[(4-methylphenyl)methyl]carbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide |
| SMILES | C/N=C(\NCc1ccc(C)cc1)NCc1cccnc1N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C22H30N6O/c1-16-5-7-17(8-6-16)14-26-22(24-2)27-15-19-4-3-11-25-21(19)28-12-9-18(10-13-28)20(23)29/h3-8,11,18H,9-10,12-15H2,1-2H3,(H2,23,29)(H2,24,26,27) |
| InChIKey | ZIABYODZCFJOJW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|