C23H38N6O2 — CID 111575157
1-[3-[[[N-(2-cycloheptyloxyethyl)-N'-methylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide (PubChem CID 111575157) has the molecular formula C23H38N6O2 and a molecular weight of 430.60 g/mol. Its IUPAC name is 1-[3-[[[N-(2-cycloheptyloxyethyl)-N'-methylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-[[[N-(2-cycloheptyloxyethyl)-N'-methylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 111575157 |
| Molecular Formula | C23H38N6O2 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | 1-[3-[[[N-(2-cycloheptyloxyethyl)-N'-methylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide |
| SMILES | C/N=C(/NCCOC1CCCCCC1)NCc1cccnc1N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C23H38N6O2/c1-25-23(27-13-16-31-20-8-4-2-3-5-9-20)28-17-19-7-6-12-26-22(19)29-14-10-18(11-15-29)21(24)30/h6-7,12,18,20H,2-5,8-11,13-17H2,1H3,(H2,24,30)(H2,25,27,28) |
| InChIKey | ZIZIGKQTBZSPNA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|