C23H39IN6O2 — CID 111575734
1-[3-[[[N-(2-cycloheptyloxyethyl)-N'-methylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide;hydroiodide (PubChem CID 111575734) has the molecular formula C23H39IN6O2 and a molecular weight of 558.51 g/mol. Its IUPAC name is 1-[3-[[[N-(2-cycloheptyloxyethyl)-N'-methylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide;hydroiodide.
| Compound Name | 1-[3-[[[N-(2-cycloheptyloxyethyl)-N'-methylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111575734 |
| Molecular Formula | C23H39IN6O2 |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | 1-[3-[[[N-(2-cycloheptyloxyethyl)-N'-methylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide;hydroiodide |
| SMILES | C/N=C(/NCCOC1CCCCCC1)NCc1cccnc1N1CCCC(C(N)=O)C1.I |
| InChI | InChI=1S/C23H38N6O2.HI/c1-25-23(27-13-15-31-20-10-4-2-3-5-11-20)28-16-18-8-6-12-26-22(18)29-14-7-9-19(17-29)21(24)30;/h6,8,12,19-20H,2-5,7,9-11,13-17H2,1H3,(H2,24,30)(H2,25,27,28);1H |
| InChIKey | PKYQIKQRDRJOLU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|