C22H31IN6O2 — CID 111183123
1-[3-[[[N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide;hydroiodide (PubChem CID 111183123) has the molecular formula C22H31IN6O2 and a molecular weight of 538.43 g/mol. Its IUPAC name is 1-[3-[[[N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide;hydroiodide.
| Compound Name | 1-[3-[[[N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111183123 |
| Molecular Formula | C22H31IN6O2 |
| Molecular Weight | 538.43 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | 1-[3-[[[N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(OC)cc1)NCc1cccnc1N1CCCC(C(N)=O)C1.I |
| InChI | InChI=1S/C22H30N6O2.HI/c1-24-22(26-13-16-7-9-19(30-2)10-8-16)27-14-17-5-3-11-25-21(17)28-12-4-6-18(15-28)20(23)29;/h3,5,7-11,18H,4,6,12-15H2,1-2H3,(H2,23,29)(H2,24,26,27);1H |
| InChIKey | JDKJVXSWZQQTPD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|