C21H30N6OS — CID 111957361
1-[3-[[[N-[(5-ethylthiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide (PubChem CID 111957361) has the molecular formula C21H30N6OS and a molecular weight of 414.58 g/mol. Its IUPAC name is 1-[3-[[[N-[(5-ethylthiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[[[N-[(5-ethylthiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 111957361 |
| Molecular Formula | C21H30N6OS |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 1-[3-[[[N-[(5-ethylthiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide |
| SMILES | CCc1ccc(CN/C(=N\C)NCc2cccnc2N2CCCC(C(N)=O)C2)s1 |
| InChI | InChI=1S/C21H30N6OS/c1-3-17-8-9-18(29-17)13-26-21(23-2)25-12-15-6-4-10-24-20(15)27-11-5-7-16(14-27)19(22)28/h4,6,8-10,16H,3,5,7,11-14H2,1-2H3,(H2,22,28)(H2,23,25,26) |
| InChIKey | DPAIJANIXIBPBB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|